C11H15F3N2O3S — CID 78858516
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide (PubChem CID 78858516) has the molecular formula C11H15F3N2O3S and a molecular weight of 312.31 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide.
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 78858516 |
| Molecular Formula | C11H15F3N2O3S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O3S/c1-8-6-20-10(18)16(8)5-9(17)15-3-2-4-19-7-11(12,13)14/h6H,2-5,7H2,1H3,(H,15,17) |
| InChIKey | BTOQTIDRMSCHAK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|