C22H24N6O2 — CID 78858542
N-benzyl-1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidine-4-carboxamide (PubChem CID 78858542) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-benzyl-1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78858542 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-benzyl-1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCN(C(=O)Cc2ccc(-n3cnnn3)cc2)CC1 |
| InChI | InChI=1S/C22H24N6O2/c29-21(14-17-6-8-20(9-7-17)28-16-24-25-26-28)27-12-10-19(11-13-27)22(30)23-15-18-4-2-1-3-5-18/h1-9,16,19H,10-15H2,(H,23,30) |
| InChIKey | HQDZXIJSESYTTR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |