C19H19FN4O3S — CID 78858955
[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-(5-methyl-1H-indazol-3-yl)methanone (PubChem CID 78858955) has the molecular formula C19H19FN4O3S and a molecular weight of 402.45 g/mol. Its IUPAC name is [4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-(5-methyl-1H-indazol-3-yl)methanone.
| Compound Name | [4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-(5-methyl-1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 78858955 |
| Molecular Formula | C19H19FN4O3S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-(5-methyl-1H-indazol-3-yl)methanone |
| SMILES | Cc1ccc2[nH]nc(C(=O)N3CCN(S(=O)(=O)c4ccc(F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C19H19FN4O3S/c1-13-2-7-17-16(12-13)18(22-21-17)19(25)23-8-10-24(11-9-23)28(26,27)15-5-3-14(20)4-6-15/h2-7,12H,8-11H2,1H3,(H,21,22) |
| InChIKey | LFOPGLXRZFMAEU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |