C20H20N4O2 — CID 78859139
5-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1H-indazole-3-carboxamide (PubChem CID 78859139) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 5-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1H-indazole-3-carboxamide.
| Compound Name | 5-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 78859139 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc2[nH]nc(C(=O)NCc3ccc(N4CCCC4=O)cc3)c2c1 |
| InChI | InChI=1S/C20H20N4O2/c1-13-4-9-17-16(11-13)19(23-22-17)20(26)21-12-14-5-7-15(8-6-14)24-10-2-3-18(24)25/h4-9,11H,2-3,10,12H2,1H3,(H,21,26)(H,22,23) |
| InChIKey | RFIXRUMDFANLDT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |