C16H12ClF2N3O2 — CID 78859177
N-[3-chloro-4-(difluoromethoxy)phenyl]-5-methyl-1H-indazole-3-carboxamide (PubChem CID 78859177) has the molecular formula C16H12ClF2N3O2 and a molecular weight of 351.74 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-5-methyl-1H-indazole-3-carboxamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-5-methyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 78859177 |
| Molecular Formula | C16H12ClF2N3O2 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-5-methyl-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc2[nH]nc(C(=O)Nc3ccc(OC(F)F)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C16H12ClF2N3O2/c1-8-2-4-12-10(6-8)14(22-21-12)15(23)20-9-3-5-13(11(17)7-9)24-16(18)19/h2-7,16H,1H3,(H,20,23)(H,21,22) |
| InChIKey | PLMZTYBRKFHPKJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |