C24H28N4O3 — CID 78859579
4-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)-N-(2,4,6-trimethyl-3-pyridinyl)butanamide (PubChem CID 78859579) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)-N-(2,4,6-trimethyl-3-pyridinyl)butanamide.
| Compound Name | 4-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)-N-(2,4,6-trimethyl-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 78859579 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 4-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)-N-(2,4,6-trimethyl-3-pyridinyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCN2C(=O)c3ccccc3N3C(=O)CCC23C)c(C)n1 |
| InChI | InChI=1S/C24H28N4O3/c1-15-14-16(2)25-17(3)22(15)26-20(29)10-7-13-27-23(31)18-8-5-6-9-19(18)28-21(30)11-12-24(27,28)4/h5-6,8-9,14H,7,10-13H2,1-4H3,(H,26,29) |
| InChIKey | JKENQDKVIZLBPT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |