C11H16F3NO3S2 — CID 78860555
2,5-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]thiophene-3-sulfonamide (PubChem CID 78860555) has the molecular formula C11H16F3NO3S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2,5-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 78860555 |
| Molecular Formula | C11H16F3NO3S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 2,5-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCOCC(F)(F)F)c(C)s1 |
| InChI | InChI=1S/C11H16F3NO3S2/c1-8-6-10(9(2)19-8)20(16,17)15-4-3-5-18-7-11(12,13)14/h6,15H,3-5,7H2,1-2H3 |
| InChIKey | PJFZHLXWBJNNDO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|