C18H25F2N3O — CID 78860870
N-[[4-(difluoromethoxy)-3,5-dimethylphenyl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine (PubChem CID 78860870) has the molecular formula C18H25F2N3O and a molecular weight of 337.41 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3,5-dimethylphenyl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine.
| Compound Name | N-[[4-(difluoromethoxy)-3,5-dimethylphenyl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 78860870 |
| Molecular Formula | C18H25F2N3O |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3,5-dimethylphenyl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1cc(CNCCc2c(C)nn(C)c2C)cc(C)c1OC(F)F |
| InChI | InChI=1S/C18H25F2N3O/c1-11-8-15(9-12(2)17(11)24-18(19)20)10-21-7-6-16-13(3)22-23(5)14(16)4/h8-9,18,21H,6-7,10H2,1-5H3 |
| InChIKey | NJSXKWBSICVOTB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|