C21H28N8S — CID 78860945
2-N,2-N-dimethyl-6-[1-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 78860945) has the molecular formula C21H28N8S and a molecular weight of 424.58 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[1-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[1-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 78860945 |
| Molecular Formula | C21H28N8S |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[1-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(c1nc(N)nc(N(C)C)n1)N1CCN(Cc2csc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C21H28N8S/c1-15(18-24-20(22)26-21(25-18)27(2)3)29-11-9-28(10-12-29)13-17-14-30-19(23-17)16-7-5-4-6-8-16/h4-8,14-15H,9-13H2,1-3H3,(H2,22,24,25,26) |
| InChIKey | IMZHXDAJLGIDKJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |