About 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide
1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide (PubChem CID 78861023) has the molecular formula C14H12N6O2
and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide |
| PubChem CID | 78861023 |
| Molecular Formula | C14H12N6O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc[nH]1)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C14H12N6O2/c21-13(11-7-4-8-15-11)17-18-14(22)12-9-20(19-16-12)10-5-2-1-3-6-10/h1-9,15H,(H,17,21)(H,18,22) |
| InChIKey | VDDHVTJQIQVLRI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide?
The IUPAC name of 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide (CID 78861023) is 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide.
What is the SMILES notation for 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide?
The canonical SMILES for 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide is O=C(NNC(=O)c1ccc[nH]1)c1cn(-c2ccccc2)nn1.
What is the InChIKey of 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide?
The InChIKey is VDDHVTJQIQVLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N6O2/c21-13(11-7-4-8-15-11)17-18-14(22)12-9-20(19-16-12)10-5-2-1-3-6-10/h1-9,15H,(H,17,21)(H,18,22).
What are the key properties of 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide?
1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide has a molecular weight of 296.29 g/mol, XLogP of 0.67, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N'-(1H-pyrrole-2-carbonyl)triazole-4-carbohydrazide is sourced from PubChem (CID 78861023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).