C15H15N5O3S — CID 78861985
N'-[5-[(1-methylimidazol-2-yl)sulfanylmethyl]furan-2-carbonyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78861985) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is N'-[5-[(1-methylimidazol-2-yl)sulfanylmethyl]furan-2-carbonyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[5-[(1-methylimidazol-2-yl)sulfanylmethyl]furan-2-carbonyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78861985 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N'-[5-[(1-methylimidazol-2-yl)sulfanylmethyl]furan-2-carbonyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | Cn1ccnc1SCc1ccc(C(=O)NNC(=O)c2ccc[nH]2)o1 |
| InChI | InChI=1S/C15H15N5O3S/c1-20-8-7-17-15(20)24-9-10-4-5-12(23-10)14(22)19-18-13(21)11-3-2-6-16-11/h2-8,16H,9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | JDWHJNKDJCOLPG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|