C24H24N2O2S — CID 7886214
3-[2-(1-adamantyl)-2-oxoethyl]-6-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 7886214) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 3-[2-(1-adamantyl)-2-oxoethyl]-6-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(1-adamantyl)-2-oxoethyl]-6-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7886214 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-[2-(1-adamantyl)-2-oxoethyl]-6-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | O=C(Cn1cnc2sc(-c3ccccc3)cc2c1=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H24N2O2S/c27-21(24-10-15-6-16(11-24)8-17(7-15)12-24)13-26-14-25-22-19(23(26)28)9-20(29-22)18-4-2-1-3-5-18/h1-5,9,14-17H,6-8,10-13H2 |
| InChIKey | AWLUJOGOQTVXQC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |