C19H18N6O4 — CID 78862319
1-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]-N'-(1H-pyrrole-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 78862319) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is 1-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]-N'-(1H-pyrrole-2-carbonyl)piperidine-4-carbohydrazide.
| Compound Name | 1-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]-N'-(1H-pyrrole-2-carbonyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 78862319 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]-N'-(1H-pyrrole-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | N#Cc1nc(-c2ccco2)oc1N1CCC(C(=O)NNC(=O)c2ccc[nH]2)CC1 |
| InChI | InChI=1S/C19H18N6O4/c20-11-14-19(29-18(22-14)15-4-2-10-28-15)25-8-5-12(6-9-25)16(26)23-24-17(27)13-3-1-7-21-13/h1-4,7,10,12,21H,5-6,8-9H2,(H,23,26)(H,24,27) |
| InChIKey | FBFWEEFOECORSH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 140.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|