About 2-chloro-6,7-dimethylquinoline-3-carbaldehyde
2-chloro-6,7-dimethylquinoline-3-carbaldehyde (PubChem CID 788657) has the molecular formula C12H10ClNO
and a molecular weight of 219.67 g/mol. Its IUPAC name is 2-chloro-6,7-dimethylquinoline-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-chloro-6,7-dimethylquinoline-3-carbaldehyde |
| PubChem CID | 788657 |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-chloro-6,7-dimethylquinoline-3-carbaldehyde |
| SMILES | Cc1cc2cc(C=O)c(Cl)nc2cc1C |
| InChI | InChI=1S/C12H10ClNO/c1-7-3-9-5-10(6-15)12(13)14-11(9)4-8(7)2/h3-6H,1-2H3 |
| InChIKey | MRKMNOLGKUJUSJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6,7-dimethylquinoline-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,7-dimethylquinoline-3-carbaldehyde?
The IUPAC name of 2-chloro-6,7-dimethylquinoline-3-carbaldehyde (CID 788657) is 2-chloro-6,7-dimethylquinoline-3-carbaldehyde.
What is the SMILES notation for 2-chloro-6,7-dimethylquinoline-3-carbaldehyde?
The canonical SMILES for 2-chloro-6,7-dimethylquinoline-3-carbaldehyde is Cc1cc2cc(C=O)c(Cl)nc2cc1C.
What is the InChIKey of 2-chloro-6,7-dimethylquinoline-3-carbaldehyde?
The InChIKey is MRKMNOLGKUJUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO/c1-7-3-9-5-10(6-15)12(13)14-11(9)4-8(7)2/h3-6H,1-2H3.
What are the key properties of 2-chloro-6,7-dimethylquinoline-3-carbaldehyde?
2-chloro-6,7-dimethylquinoline-3-carbaldehyde has a molecular weight of 219.67 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,7-dimethylquinoline-3-carbaldehyde is sourced from PubChem (CID 788657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).