C18H17ClFN5O — CID 78866079
2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[1-(2-fluorophenyl)ethyl]-N-methylacetamide (PubChem CID 78866079) has the molecular formula C18H17ClFN5O and a molecular weight of 373.82 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[1-(2-fluorophenyl)ethyl]-N-methylacetamide.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[1-(2-fluorophenyl)ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 78866079 |
| Molecular Formula | C18H17ClFN5O |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-[1-(2-fluorophenyl)ethyl]-N-methylacetamide |
| SMILES | CC(c1ccccc1F)N(C)C(=O)Cn1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H17ClFN5O/c1-12(15-5-3-4-6-16(15)20)24(2)17(26)11-25-22-18(21-23-25)13-7-9-14(19)10-8-13/h3-10,12H,11H2,1-2H3 |
| InChIKey | JSNAUHZUEPHMRQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |