C19H25NO5 — CID 78867521
5-(methoxymethyl)-N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]furan-2-carboxamide (PubChem CID 78867521) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78867521 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-(methoxymethyl)-N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)NC(C)c2ccc(OC(C)C)c(OC)c2)o1 |
| InChI | InChI=1S/C19H25NO5/c1-12(2)24-16-8-6-14(10-18(16)23-5)13(3)20-19(21)17-9-7-15(25-17)11-22-4/h6-10,12-13H,11H2,1-5H3,(H,20,21) |
| InChIKey | IVQHTWNSDZDQBP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |