C17H23N5O5 — CID 7887021
N-(cyclopentylcarbamoyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide (PubChem CID 7887021) has the molecular formula C17H23N5O5 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 7887021 |
| Molecular Formula | C17H23N5O5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NC(=O)NC2CCCC2)c1=O |
| InChI | InChI=1S/C17H23N5O5/c1-3-9-20-15(25)21(10-4-2)17(27)22(16(20)26)11-13(23)19-14(24)18-12-7-5-6-8-12/h3-4,12H,1-2,5-11H2,(H2,18,19,23,24) |
| InChIKey | YWARIYULFXEHJC-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|