C22H34N4O3 — CID 78871045
N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]-2-[3-(2-oxopyrrolidin-1-yl)phenoxy]acetamide (PubChem CID 78871045) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]-2-[3-(2-oxopyrrolidin-1-yl)phenoxy]acetamide.
| Compound Name | N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]-2-[3-(2-oxopyrrolidin-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 78871045 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]-2-[3-(2-oxopyrrolidin-1-yl)phenoxy]acetamide |
| SMILES | CC(C)C(CNC(=O)COc1cccc(N2CCCC2=O)c1)N1CCN(C)CC1 |
| InChI | InChI=1S/C22H34N4O3/c1-17(2)20(25-12-10-24(3)11-13-25)15-23-21(27)16-29-19-7-4-6-18(14-19)26-9-5-8-22(26)28/h4,6-7,14,17,20H,5,8-13,15-16H2,1-3H3,(H,23,27) |
| InChIKey | COXHGFAXAWJEDM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |