About N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine
N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine (PubChem CID 78871100) has the molecular formula C17H36N2O
and a molecular weight of 284.49 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine |
| PubChem CID | 78871100 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine |
| SMILES | COCCN(C)CCCNC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H36N2O/c1-17(2,3)15-7-9-16(10-8-15)18-11-6-12-19(4)13-14-20-5/h15-16,18H,6-14H2,1-5H3 |
| InChIKey | IXJQYRWJLVCZKD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine?
The IUPAC name of N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine (CID 78871100) is N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine is COCCN(C)CCCNC1CCC(C(C)(C)C)CC1.
What is the InChIKey of N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine?
The InChIKey is IXJQYRWJLVCZKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36N2O/c1-17(2,3)15-7-9-16(10-8-15)18-11-6-12-19(4)13-14-20-5/h15-16,18H,6-14H2,1-5H3.
What are the key properties of N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine?
N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine has a molecular weight of 284.49 g/mol, XLogP of 3.15, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butylcyclohexyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 78871100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).