About 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine
4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine (PubChem CID 78871227) has the molecular formula C15H17ClN2O
and a molecular weight of 276.77 g/mol. Its IUPAC name is 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine |
| PubChem CID | 78871227 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(c2ccnc3cc(Cl)ccc23)CCO1 |
| InChI | InChI=1S/C15H17ClN2O/c1-15(2)10-18(7-8-19-15)14-5-6-17-13-9-11(16)3-4-12(13)14/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | XIMQTYBGBNHBQZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine?
The IUPAC name of 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine (CID 78871227) is 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine.
What is the SMILES notation for 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine?
The canonical SMILES for 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine is CC1(C)CN(c2ccnc3cc(Cl)ccc23)CCO1.
What is the InChIKey of 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine?
The InChIKey is XIMQTYBGBNHBQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClN2O/c1-15(2)10-18(7-8-19-15)14-5-6-17-13-9-11(16)3-4-12(13)14/h3-6,9H,7-8,10H2,1-2H3.
What are the key properties of 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine?
4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine has a molecular weight of 276.77 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-chloroquinolin-4-yl)-2,2-dimethylmorpholine is sourced from PubChem (CID 78871227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).