About 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide
3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide (PubChem CID 78873454) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide.
Molecular Properties
| Compound Name | 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide |
| PubChem CID | 78873454 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCOCC(C)C)c(C)n1 |
| InChI | InChI=1S/C15H24N2O2/c1-10(2)9-19-7-6-14(18)17-15-11(3)8-12(4)16-13(15)5/h8,10H,6-7,9H2,1-5H3,(H,17,18) |
| InChIKey | ALLSZKQPGABEOF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide?
The IUPAC name of 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide (CID 78873454) is 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide.
What is the SMILES notation for 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide?
The canonical SMILES for 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide is Cc1cc(C)c(NC(=O)CCOCC(C)C)c(C)n1.
What is the InChIKey of 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide?
The InChIKey is ALLSZKQPGABEOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-10(2)9-19-7-6-14(18)17-15-11(3)8-12(4)16-13(15)5/h8,10H,6-7,9H2,1-5H3,(H,17,18).
What are the key properties of 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide?
3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide has a molecular weight of 264.37 g/mol, XLogP of 3.01, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpropoxy)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide is sourced from PubChem (CID 78873454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).