C17H17BrN2O2S — CID 78873467
N-[2-(5-bromothiophen-2-yl)ethyl]-2-(5-methoxy-1H-indol-3-yl)acetamide (PubChem CID 78873467) has the molecular formula C17H17BrN2O2S and a molecular weight of 393.31 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-2-(5-methoxy-1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2-(5-methoxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 78873467 |
| Molecular Formula | C17H17BrN2O2S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2-(5-methoxy-1H-indol-3-yl)acetamide |
| SMILES | COc1ccc2[nH]cc(CC(=O)NCCc3ccc(Br)s3)c2c1 |
| InChI | InChI=1S/C17H17BrN2O2S/c1-22-12-2-4-15-14(9-12)11(10-20-15)8-17(21)19-7-6-13-3-5-16(18)23-13/h2-5,9-10,20H,6-8H2,1H3,(H,19,21) |
| InChIKey | HOUYSKOVWBQONU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |