C21H23N3OS2 — CID 7887400
(2R)-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide (PubChem CID 7887400) has the molecular formula C21H23N3OS2 and a molecular weight of 397.57 g/mol. Its IUPAC name is (2R)-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide.
| Compound Name | (2R)-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
|---|---|
| PubChem CID | 7887400 |
| Molecular Formula | C21H23N3OS2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2R)-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
| SMILES | Cc1sc2ncnc(S[C@H](C)C(=O)N[C@H]3CCCc4ccccc43)c2c1C |
| InChI | InChI=1S/C21H23N3OS2/c1-12-13(2)26-20-18(12)21(23-11-22-20)27-14(3)19(25)24-17-10-6-8-15-7-4-5-9-16(15)17/h4-5,7,9,11,14,17H,6,8,10H2,1-3H3,(H,24,25)/t14-,17+/m1/s1 |
| InChIKey | RNMZSNBHHSEUBO-PBHICJAKSA-N |
| XLogP | 4.98 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |