About (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate
(3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 78874043) has the molecular formula C15H23NO2S
and a molecular weight of 281.42 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate.
Molecular Properties
| Compound Name | (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate |
| PubChem CID | 78874043 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | CC1CCCC(OC(=O)Cc2csc(C(C)C)n2)C1 |
| InChI | InChI=1S/C15H23NO2S/c1-10(2)15-16-12(9-19-15)8-14(17)18-13-6-4-5-11(3)7-13/h9-11,13H,4-8H2,1-3H3 |
| InChIKey | USJZCMWOYAXKHG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate?
The IUPAC name of (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate (CID 78874043) is (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate.
What is the SMILES notation for (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate?
The canonical SMILES for (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate is CC1CCCC(OC(=O)Cc2csc(C(C)C)n2)C1.
What is the InChIKey of (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate?
The InChIKey is USJZCMWOYAXKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2S/c1-10(2)15-16-12(9-19-15)8-14(17)18-13-6-4-5-11(3)7-13/h9-11,13H,4-8H2,1-3H3.
What are the key properties of (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate?
(3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate has a molecular weight of 281.42 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 2-(2-propan-2-yl-1,3-thiazol-4-yl)acetate is sourced from PubChem (CID 78874043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).