About 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea
1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 78874574) has the molecular formula C16H21N3OS
and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 78874574 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | CCCCN(CC)C(=O)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H21N3OS/c1-3-5-11-19(4-2)16(20)18-15-17-12-14(21-15)13-9-7-6-8-10-13/h6-10,12H,3-5,11H2,1-2H3,(H,17,18,20) |
| InChIKey | STYHSSCMWCSSNB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea (CID 78874574) is 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea is CCCCN(CC)C(=O)Nc1ncc(-c2ccccc2)s1.
What is the InChIKey of 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea?
The InChIKey is STYHSSCMWCSSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3OS/c1-3-5-11-19(4-2)16(20)18-15-17-12-14(21-15)13-9-7-6-8-10-13/h6-10,12H,3-5,11H2,1-2H3,(H,17,18,20).
What are the key properties of 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea?
1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea has a molecular weight of 303.43 g/mol, XLogP of 4.46, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1-ethyl-3-(5-phenyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 78874574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).