About 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea
1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea (PubChem CID 78874975) has the molecular formula C17H19F3N4O2S
and a molecular weight of 400.43 g/mol. Its IUPAC name is 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
| PubChem CID | 78874975 |
| Molecular Formula | C17H19F3N4O2S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)Nc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C17H19F3N4O2S/c1-23(16(25)22-15-21-14(11-27-15)17(18,19)20)10-12-2-4-13(5-3-12)24-6-8-26-9-7-24/h2-5,11H,6-10H2,1H3,(H,21,22,25) |
| InChIKey | BVYPIGDVISSRLR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea?
The IUPAC name of 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea (CID 78874975) is 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea.
What is the SMILES notation for 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea?
The canonical SMILES for 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea is CN(Cc1ccc(N2CCOCC2)cc1)C(=O)Nc1nc(C(F)(F)F)cs1.
What is the InChIKey of 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea?
The InChIKey is BVYPIGDVISSRLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3N4O2S/c1-23(16(25)22-15-21-14(11-27-15)17(18,19)20)10-12-2-4-13(5-3-12)24-6-8-26-9-7-24/h2-5,11H,6-10H2,1H3,(H,21,22,25).
What are the key properties of 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea?
1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea has a molecular weight of 400.43 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea is sourced from PubChem (CID 78874975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).