C21H28N2O3 — CID 78876241
5-(methoxymethyl)-N-[[4-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]furan-2-carboxamide (PubChem CID 78876241) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[[4-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]furan-2-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-[[4-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78876241 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 5-(methoxymethyl)-N-[[4-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)NCc2ccc(CN3CCCC(C)C3)cc2)o1 |
| InChI | InChI=1S/C21H28N2O3/c1-16-4-3-11-23(13-16)14-18-7-5-17(6-8-18)12-22-21(24)20-10-9-19(26-20)15-25-2/h5-10,16H,3-4,11-15H2,1-2H3,(H,22,24) |
| InChIKey | BSPBLRCBPLADON-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |