C19H24N2O4 — CID 78877222
(5-oxopyrrolidin-2-yl)methyl 3-(cyclohexanecarbonylamino)benzoate (PubChem CID 78877222) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (5-oxopyrrolidin-2-yl)methyl 3-(cyclohexanecarbonylamino)benzoate.
| Compound Name | (5-oxopyrrolidin-2-yl)methyl 3-(cyclohexanecarbonylamino)benzoate |
|---|---|
| PubChem CID | 78877222 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (5-oxopyrrolidin-2-yl)methyl 3-(cyclohexanecarbonylamino)benzoate |
| SMILES | O=C1CCC(COC(=O)c2cccc(NC(=O)C3CCCCC3)c2)N1 |
| InChI | InChI=1S/C19H24N2O4/c22-17-10-9-16(20-17)12-25-19(24)14-7-4-8-15(11-14)21-18(23)13-5-2-1-3-6-13/h4,7-8,11,13,16H,1-3,5-6,9-10,12H2,(H,20,22)(H,21,23) |
| InChIKey | DENJSTNDVLLKJY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |