C24H29N3O3S — CID 78877702
4-[(1-benzylimidazol-2-yl)methylsulfonyl]-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 78877702) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 4-[(1-benzylimidazol-2-yl)methylsulfonyl]-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-[(1-benzylimidazol-2-yl)methylsulfonyl]-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 78877702 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-[(1-benzylimidazol-2-yl)methylsulfonyl]-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCS(=O)(=O)Cc2nccn2Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H29N3O3S/c1-18-14-19(2)24(20(3)15-18)26-23(28)10-7-13-31(29,30)17-22-25-11-12-27(22)16-21-8-5-4-6-9-21/h4-6,8-9,11-12,14-15H,7,10,13,16-17H2,1-3H3,(H,26,28) |
| InChIKey | BEINKMLBIVEHTJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |