C21H19N3O — CID 78877817
4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-naphthalen-2-ylbenzamide (PubChem CID 78877817) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-naphthalen-2-ylbenzamide.
| Compound Name | 4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-naphthalen-2-ylbenzamide |
|---|---|
| PubChem CID | 78877817 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-naphthalen-2-ylbenzamide |
| SMILES | CC1=NN(c2ccc(C(=O)Nc3ccc4ccccc4c3)cc2)CC1 |
| InChI | InChI=1S/C21H19N3O/c1-15-12-13-24(23-15)20-10-7-17(8-11-20)21(25)22-19-9-6-16-4-2-3-5-18(16)14-19/h2-11,14H,12-13H2,1H3,(H,22,25) |
| InChIKey | YFXHKTYSDXJTRK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |