C21H24N2O3 — CID 78878320
N-[2-(azepan-1-yl)phenyl]-2-(4-formylphenoxy)acetamide (PubChem CID 78878320) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)phenyl]-2-(4-formylphenoxy)acetamide.
| Compound Name | N-[2-(azepan-1-yl)phenyl]-2-(4-formylphenoxy)acetamide |
|---|---|
| PubChem CID | 78878320 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[2-(azepan-1-yl)phenyl]-2-(4-formylphenoxy)acetamide |
| SMILES | O=Cc1ccc(OCC(=O)Nc2ccccc2N2CCCCCC2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c24-15-17-9-11-18(12-10-17)26-16-21(25)22-19-7-3-4-8-20(19)23-13-5-1-2-6-14-23/h3-4,7-12,15H,1-2,5-6,13-14,16H2,(H,22,25) |
| InChIKey | DMPDIJBRMLRDSR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|