C14H8Cl3N5O — CID 78878372
2,6-dichloro-N-[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]pyridine-4-carboxamide (PubChem CID 78878372) has the molecular formula C14H8Cl3N5O and a molecular weight of 368.61 g/mol. Its IUPAC name is 2,6-dichloro-N-[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 78878372 |
| Molecular Formula | C14H8Cl3N5O |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 2,6-dichloro-N-[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1n[nH]c(-c2ccccc2Cl)n1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C14H8Cl3N5O/c15-9-4-2-1-3-8(9)12-19-14(22-21-12)20-13(23)7-5-10(16)18-11(17)6-7/h1-6H,(H2,19,20,21,22,23) |
| InChIKey | HJERQABKSOABPR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|