C21H21N3O3S — CID 78878451
4-[2-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-2-oxoethoxy]benzaldehyde (PubChem CID 78878451) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-[2-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-2-oxoethoxy]benzaldehyde.
| Compound Name | 4-[2-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-2-oxoethoxy]benzaldehyde |
|---|---|
| PubChem CID | 78878451 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-[2-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-2-oxoethoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCC(=O)N2CCN(Cc3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c25-14-16-5-7-17(8-6-16)27-15-21(26)24-11-9-23(10-12-24)13-20-22-18-3-1-2-4-19(18)28-20/h1-8,14H,9-13,15H2 |
| InChIKey | PEQQOSBIRFGENT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|