C17H21ClF3N5O — CID 78878617
3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyridine-2-carboxamide (PubChem CID 78878617) has the molecular formula C17H21ClF3N5O and a molecular weight of 403.84 g/mol. Its IUPAC name is 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 78878617 |
| Molecular Formula | C17H21ClF3N5O |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(Cl)c(C(=O)NCCCN(C)CC(F)(F)F)n2)n1 |
| InChI | InChI=1S/C17H21ClF3N5O/c1-11-9-12(2)26(24-11)14-6-5-13(18)15(23-14)16(27)22-7-4-8-25(3)10-17(19,20)21/h5-6,9H,4,7-8,10H2,1-3H3,(H,22,27) |
| InChIKey | TYCRZKQRFRNJQY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|