C20H16N4O3 — CID 78879020
3'-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 78879020) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is 3'-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 78879020 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3'-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCc3ccccc32)C(=O)N1Cc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H16N4O3/c25-18-20(11-10-13-6-4-5-9-15(13)20)22-19(26)24(18)12-16-21-17(27-23-16)14-7-2-1-3-8-14/h1-9H,10-12H2,(H,22,26) |
| InChIKey | VLXXWUYMMZXXSU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|