C24H29N5O2 — CID 78879060
1-benzyl-5-ethyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyrazole-4-carboxamide (PubChem CID 78879060) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-benzyl-5-ethyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-5-ethyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78879060 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 1-benzyl-5-ethyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCc2ccc(N3CCOC(C)C3)nc2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C24H29N5O2/c1-3-22-21(15-27-29(22)17-19-7-5-4-6-8-19)24(30)26-14-20-9-10-23(25-13-20)28-11-12-31-18(2)16-28/h4-10,13,15,18H,3,11-12,14,16-17H2,1-2H3,(H,26,30) |
| InChIKey | DPZFPXOEBYGHDV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |