C15H21N3O2S — CID 78879100
3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione (PubChem CID 78879100) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 78879100 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)c1nc(CN2C(=O)NC(C)(C3CC3)C2=O)cs1 |
| InChI | InChI=1S/C15H21N3O2S/c1-14(2,3)11-16-10(8-21-11)7-18-12(19)15(4,9-5-6-9)17-13(18)20/h8-9H,5-7H2,1-4H3,(H,17,20) |
| InChIKey | QGQRCLQYMIWKPZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|