C22H38N4O2 — CID 78879244
1-[3-[cyclohexyl(methyl)amino]propyl]-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea (PubChem CID 78879244) has the molecular formula C22H38N4O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 1-[3-[cyclohexyl(methyl)amino]propyl]-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[3-[cyclohexyl(methyl)amino]propyl]-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 78879244 |
| Molecular Formula | C22H38N4O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 1-[3-[cyclohexyl(methyl)amino]propyl]-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea |
| SMILES | COc1cccc(C(CNC(=O)NCCCN(C)C2CCCCC2)N(C)C)c1 |
| InChI | InChI=1S/C22H38N4O2/c1-25(2)21(18-10-8-13-20(16-18)28-4)17-24-22(27)23-14-9-15-26(3)19-11-6-5-7-12-19/h8,10,13,16,19,21H,5-7,9,11-12,14-15,17H2,1-4H3,(H2,23,24,27) |
| InChIKey | CSQQMONNKNYXTR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|