C17H21FN4O3 — CID 78881404
N-cyclopropyl-2-[4-[2-(2-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-2-oxoacetamide (PubChem CID 78881404) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[2-(2-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-cyclopropyl-2-[4-[2-(2-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 78881404 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-cyclopropyl-2-[4-[2-(2-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-2-oxoacetamide |
| SMILES | O=C(CN1CCN(C(=O)C(=O)NC2CC2)CC1)Nc1ccccc1F |
| InChI | InChI=1S/C17H21FN4O3/c18-13-3-1-2-4-14(13)20-15(23)11-21-7-9-22(10-8-21)17(25)16(24)19-12-5-6-12/h1-4,12H,5-11H2,(H,19,24)(H,20,23) |
| InChIKey | OTSPCKVMVQYOPB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|