C19H28N4O — CID 78881517
N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-4-morpholin-4-ylbutan-1-amine (PubChem CID 78881517) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-4-morpholin-4-ylbutan-1-amine.
| Compound Name | N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-4-morpholin-4-ylbutan-1-amine |
|---|---|
| PubChem CID | 78881517 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-4-morpholin-4-ylbutan-1-amine |
| SMILES | Cc1ccc(-c2[nH]ncc2CNCCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C19H28N4O/c1-16-4-6-17(7-5-16)19-18(15-21-22-19)14-20-8-2-3-9-23-10-12-24-13-11-23/h4-7,15,20H,2-3,8-14H2,1H3,(H,21,22) |
| InChIKey | HVVWNDYLUOVLBV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|