C15H19F2NO4 — CID 78884783
methyl 2-[[2-[4-(difluoromethoxy)phenyl]acetyl]-propan-2-ylamino]acetate (PubChem CID 78884783) has the molecular formula C15H19F2NO4 and a molecular weight of 315.32 g/mol. Its IUPAC name is methyl 2-[[2-[4-(difluoromethoxy)phenyl]acetyl]-propan-2-ylamino]acetate.
| Compound Name | methyl 2-[[2-[4-(difluoromethoxy)phenyl]acetyl]-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 78884783 |
| Molecular Formula | C15H19F2NO4 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl 2-[[2-[4-(difluoromethoxy)phenyl]acetyl]-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(C(=O)Cc1ccc(OC(F)F)cc1)C(C)C |
| InChI | InChI=1S/C15H19F2NO4/c1-10(2)18(9-14(20)21-3)13(19)8-11-4-6-12(7-5-11)22-15(16)17/h4-7,10,15H,8-9H2,1-3H3 |
| InChIKey | XREQTAZABGMZAW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |