C20H24ClN3O3 — CID 78885234
methyl 2-[3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl-propan-2-ylamino]acetate (PubChem CID 78885234) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is methyl 2-[3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl-propan-2-ylamino]acetate.
| Compound Name | methyl 2-[3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 78885234 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | methyl 2-[3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(C(=O)C=Cc1c(C)nn(Cc2ccccc2)c1Cl)C(C)C |
| InChI | InChI=1S/C20H24ClN3O3/c1-14(2)23(13-19(26)27-4)18(25)11-10-17-15(3)22-24(20(17)21)12-16-8-6-5-7-9-16/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | RWAPDNSIZSIEBU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|