C22H17F4N3O3 — CID 78885374
4-fluoro-N-[4-[3-(2-oxo-1-pyridinyl)propanoylamino]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 78885374) has the molecular formula C22H17F4N3O3 and a molecular weight of 447.39 g/mol. Its IUPAC name is 4-fluoro-N-[4-[3-(2-oxo-1-pyridinyl)propanoylamino]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[3-(2-oxo-1-pyridinyl)propanoylamino]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 78885374 |
| Molecular Formula | C22H17F4N3O3 |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-fluoro-N-[4-[3-(2-oxo-1-pyridinyl)propanoylamino]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(CCn1ccccc1=O)Nc1ccc(NC(=O)c2ccc(F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H17F4N3O3/c23-15-6-4-14(5-7-15)21(32)27-16-8-9-18(17(13-16)22(24,25)26)28-19(30)10-12-29-11-2-1-3-20(29)31/h1-9,11,13H,10,12H2,(H,27,32)(H,28,30) |
| InChIKey | JQCAEQWPIBUQOU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |