C20H23N5O4S — CID 78885381
N-ethyl-4-[2-(1-methylpyrazol-4-yl)ethylamino]-3-nitro-N-phenylbenzenesulfonamide (PubChem CID 78885381) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-ethyl-4-[2-(1-methylpyrazol-4-yl)ethylamino]-3-nitro-N-phenylbenzenesulfonamide.
| Compound Name | N-ethyl-4-[2-(1-methylpyrazol-4-yl)ethylamino]-3-nitro-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 78885381 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-ethyl-4-[2-(1-methylpyrazol-4-yl)ethylamino]-3-nitro-N-phenylbenzenesulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(NCCc2cnn(C)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H23N5O4S/c1-3-24(17-7-5-4-6-8-17)30(28,29)18-9-10-19(20(13-18)25(26)27)21-12-11-16-14-22-23(2)15-16/h4-10,13-15,21H,3,11-12H2,1-2H3 |
| InChIKey | XENMVURCUVWGGV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|