About (2-ethylcyclohexyl) 4-methoxybutanoate
(2-ethylcyclohexyl) 4-methoxybutanoate (PubChem CID 78885705) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 4-methoxybutanoate.
Molecular Properties
| Compound Name | (2-ethylcyclohexyl) 4-methoxybutanoate |
| PubChem CID | 78885705 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (2-ethylcyclohexyl) 4-methoxybutanoate |
| SMILES | CCC1CCCCC1OC(=O)CCCOC |
| InChI | InChI=1S/C13H24O3/c1-3-11-7-4-5-8-12(11)16-13(14)9-6-10-15-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | FDPYPCWSEVDKEM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-ethylcyclohexyl) 4-methoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylcyclohexyl) 4-methoxybutanoate?
The IUPAC name of (2-ethylcyclohexyl) 4-methoxybutanoate (CID 78885705) is (2-ethylcyclohexyl) 4-methoxybutanoate.
What is the SMILES notation for (2-ethylcyclohexyl) 4-methoxybutanoate?
The canonical SMILES for (2-ethylcyclohexyl) 4-methoxybutanoate is CCC1CCCCC1OC(=O)CCCOC.
What is the InChIKey of (2-ethylcyclohexyl) 4-methoxybutanoate?
The InChIKey is FDPYPCWSEVDKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-3-11-7-4-5-8-12(11)16-13(14)9-6-10-15-2/h11-12H,3-10H2,1-2H3.
What are the key properties of (2-ethylcyclohexyl) 4-methoxybutanoate?
(2-ethylcyclohexyl) 4-methoxybutanoate has a molecular weight of 228.33 g/mol, XLogP of 2.92, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylcyclohexyl) 4-methoxybutanoate is sourced from PubChem (CID 78885705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).