About ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate
ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate (PubChem CID 78885919) has the molecular formula C19H26N4O3S2
and a molecular weight of 422.58 g/mol. Its IUPAC name is ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate |
| PubChem CID | 78885919 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(C(=O)NCCc2ccc(-c3csc(C)n3)s2)C1 |
| InChI | InChI=1S/C19H26N4O3S2/c1-3-26-19(25)22-14-5-4-10-23(11-14)18(24)20-9-8-15-6-7-17(28-15)16-12-27-13(2)21-16/h6-7,12,14H,3-5,8-11H2,1-2H3,(H,20,24)(H,22,25) |
| InChIKey | HJKQDEXFQRRYJM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate?
The IUPAC name of ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate (CID 78885919) is ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate.
What is the SMILES notation for ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate?
The canonical SMILES for ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate is CCOC(=O)NC1CCCN(C(=O)NCCc2ccc(-c3csc(C)n3)s2)C1.
What is the InChIKey of ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate?
The InChIKey is HJKQDEXFQRRYJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O3S2/c1-3-26-19(25)22-14-5-4-10-23(11-14)18(24)20-9-8-15-6-7-17(28-15)16-12-27-13(2)21-16/h6-7,12,14H,3-5,8-11H2,1-2H3,(H,20,24)(H,22,25).
What are the key properties of ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate?
ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate has a molecular weight of 422.58 g/mol, XLogP of 3.64, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[1-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethylcarbamoyl]piperidin-3-yl]carbamate is sourced from PubChem (CID 78885919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).