About N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide
N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (PubChem CID 78886607) has the molecular formula C10H17F3N2O2
and a molecular weight of 254.25 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| PubChem CID | 78886607 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCO)C1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F3N2O2/c11-10(12,13)7-15-4-1-8(2-5-15)9(17)14-3-6-16/h8,16H,1-7H2,(H,14,17) |
| InChIKey | BNCGZJJPVVRFHO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide?
The IUPAC name of N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (CID 78886607) is N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
What is the SMILES notation for N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide?
The canonical SMILES for N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide is O=C(NCCO)C1CCN(CC(F)(F)F)CC1.
What is the InChIKey of N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide?
The InChIKey is BNCGZJJPVVRFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O2/c11-10(12,13)7-15-4-1-8(2-5-15)9(17)14-3-6-16/h8,16H,1-7H2,(H,14,17).
What are the key properties of N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide?
N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide has a molecular weight of 254.25 g/mol, XLogP of 0.37, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide is sourced from PubChem (CID 78886607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).