C23H24N4O2 — CID 78886962
1-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-3-(2-quinolin-8-ylethyl)urea (PubChem CID 78886962) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-3-(2-quinolin-8-ylethyl)urea.
| Compound Name | 1-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-3-(2-quinolin-8-ylethyl)urea |
|---|---|
| PubChem CID | 78886962 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-3-(2-quinolin-8-ylethyl)urea |
| SMILES | O=C(NCCc1cccc2cccnc12)Nc1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C23H24N4O2/c28-21-7-3-15-27(21)16-17-8-10-20(11-9-17)26-23(29)25-14-12-19-5-1-4-18-6-2-13-24-22(18)19/h1-2,4-6,8-11,13H,3,7,12,14-16H2,(H2,25,26,29) |
| InChIKey | UGZNTDJNXWBQNX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |