C20H19F2N3O2 — CID 78889307
1-benzyl-N-[3-(difluoromethoxy)phenyl]-5-ethylpyrazole-4-carboxamide (PubChem CID 78889307) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-benzyl-N-[3-(difluoromethoxy)phenyl]-5-ethylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[3-(difluoromethoxy)phenyl]-5-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78889307 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-benzyl-N-[3-(difluoromethoxy)phenyl]-5-ethylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)Nc2cccc(OC(F)F)c2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C20H19F2N3O2/c1-2-18-17(12-23-25(18)13-14-7-4-3-5-8-14)19(26)24-15-9-6-10-16(11-15)27-20(21)22/h3-12,20H,2,13H2,1H3,(H,24,26) |
| InChIKey | OYYVZTNWIGLXMP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |