C18H16Cl2N4O4 — CID 78890313
5,6-dichloro-2-[[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 78890313) has the molecular formula C18H16Cl2N4O4 and a molecular weight of 423.26 g/mol. Its IUPAC name is 5,6-dichloro-2-[[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-[[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 78890313 |
| Molecular Formula | C18H16Cl2N4O4 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 5,6-dichloro-2-[[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C(=O)N2CCN(CN3C(=O)c4cc(Cl)c(Cl)cc4C3=O)CC2)on1 |
| InChI | InChI=1S/C18H16Cl2N4O4/c1-10-6-15(28-21-10)18(27)23-4-2-22(3-5-23)9-24-16(25)11-7-13(19)14(20)8-12(11)17(24)26/h6-8H,2-5,9H2,1H3 |
| InChIKey | QBPJXWYQPQPGNC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|